Butanone facts for kids
Quick facts for kids Butanone |
|
|---|---|
 |
|
 |
 |
 |
|
|
Preferred IUPAC name
Butan-2-one
|
|
| Other names |
|
| Identifiers | |
| CAS number | |
| PubChem | |
| KEGG | C02845 |
| ChEBI | CHEBI:28398 |
| RTECS number | EL6475000 |
| SMILES | O=C(C)CC |
|
InChI
InChI=1/C4H8O/c1-3-4(2)5/h3H2,1-2H3
|
|
| Beilstein Reference | 741880 |
| Gmelin Reference | 25656 |
| Properties | |
| Molecular formula | C4H8O |
| Molar mass | 72.1 g mol-1 |
| Appearance | Colorless liquid |
| Odor | Mint or acetone-like |
| Density | 0.8050 g/mL |
| Melting point |
−86 °C, 187 K, -123 °F |
| Boiling point |
79.64 °C, 353 K, 175 °F |
| Solubility in water | 27.5 g/100 mL |
| log P | 0.37 |
| Vapor pressure | 78 mmHg (20 °C) |
| Acidity (pKa) | 14.7 |
| −45.58·10−6 cm3/mol | |
| Refractive index (nD) | 1.37880 |
| Viscosity | 0.43 cP |
| Structure | |
| Dipole moment | 2.76 D |
| Hazards | |
| EU classification | Flammable (F) Irritant (Xi) |
| NFPA 704 |
3
1
0
|
| R-phrases | R11 R36 R66 R67 |
| S-phrases | (S2) S9 S16 |
| Explosive limits | 1.4–11.4% |
| U.S. Permissible exposure limit (PEL) |
TWA 200 ppm (590 mg/m3) |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) | |
Butanone, also called methyl ethyl ketone (MEK), is an organic compound with the chemical formula CH3C(O)CH2CH3. It is a simple ketone with four carbon atoms. It smells sharp and sweet, like butterscotch and acetone mixed. It is soluble in water and is used as a solvent.
See also
In Spanish: Butanona para niños
All content from Kiddle encyclopedia articles (including the article images and facts) can be freely used under Attribution-ShareAlike license, unless stated otherwise. Cite this article:
Butanone Facts for Kids. Kiddle Encyclopedia.