Elenolic acid facts for kids
Quick facts for kids Elenolic acid |
|
|---|---|
 |
|
|
Preferred IUPAC name
[(2S,3S,4S)-3-Formyl-5-(methoxycarbonyl)-2-methyl-3,4-dihydro-2H-pyran-4-yl]acetic acid
|
|
| Identifiers | |
| CAS number | |
| PubChem | |
| SMILES | CC1C(C(C(=CO1)C(=O)OC)CC(=O)O)C=O |
|
InChI
InChI=1/C11H14O6/c1-6-8(4-12)7(3-10(13)14)9(5-17-6)11(15)16-2/h4-8H,3H2,1-2H3,(H,13,14)/t6-,7-,8+/m0/s1
|
|
| Properties | |
| Molecular formula | C11H14O6 |
| Molar mass | 242.19 g mol-1 |
| Density | 1.308 g/mL |
| Boiling point |
408.9 °C, 682 K, 768 °F |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) | |
Elenolic acid is a component of olive oil, olive infusion and olive leaf extract. It can be considered as a marker for maturation of olives.
Oleuropein, a chemical compound found in olive leaf from the olive tree, together with other closely related compounds such as 10-hydroxyoleuropein, ligstroside and 10-hydroxyligstroside, are tyrosol esters of elenolic acid.
All content from Kiddle encyclopedia articles (including the article images and facts) can be freely used under Attribution-ShareAlike license, unless stated otherwise. Cite this article:
Elenolic acid Facts for Kids. Kiddle Encyclopedia.