Methyl benzoate facts for kids
Quick facts for kids Methyl benzoate |
|
|---|---|
 |
|
| IUPAC name | Methyl benzoate |
| Identifiers | |
| CAS number | |
| PubChem | |
| SMILES | O=C(OC)c1ccccc1 |
|
InChI
InChI=1/C8H8O2/c1-10-8(9)7-5-3-2-4-6-7/h2-6H,1H3
|
|
| Properties | |
| Molecular formula | C8H8O2 |
| Molar mass | 136.14 g mol-1 |
| Density | 1.0837 g/cm³ |
| Melting point |
-12.5 °C, 261 K, 10 °F |
| Boiling point |
199.6 °C, 473 K, 391 °F |
| Refractive index (nD) | 1.5164 |
| Hazards | |
| MSDS | ScienceLab MSDS |
| NFPA 704 |
2
0
0
|
| Flash point | 82 °C |
| Related compounds | |
| Related compounds | Ethyl benzoate Propyl benzoate |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) | |
Methyl benzoate is an organic compound. It has the chemical formula C6H5CO2CH3. It is a colorless liquid that is poorly soluble in water, but miscible with organic solvents.
All content from Kiddle encyclopedia articles (including the article images and facts) can be freely used under Attribution-ShareAlike license, unless stated otherwise. Cite this article:
Methyl benzoate Facts for Kids. Kiddle Encyclopedia.