Amurensin E facts for kids
Quick facts for kids Amurensin E |
|
|---|---|
 |
|
|
Preferred IUPAC name
(21S,26R,27S,211bS,4E,65S,66S)-65-(3,5-Dihydroxyphenyl)-27,63,66-tris(4-hydroxyphenyl)-21,26,27,211b,65,66-hexahydro-2(1,6)-benzo[6,7]cyclohepta[1,2,3-cd][1]benzofurana-6(4,2)-benzo[1,2-b:5,4-b′]difurana-1,7(1),3(1,3)-tribenzenaheptaphan-4-ene-14,24,28,210,36,73,75-heptol
|
|
| Identifiers | |
| CAS number | |
| PubChem | |
| SMILES | C1=CC(=CC=C1[C@@H]2[C@H](C3=C4[C@@H]([C@H](OC4=CC(=C3)O)C5=CC=C(C=C5)O)C6=C2C(=CC(=C6)O)O)C7=C(C=CC(=C7)/C=C/C8=C9C(=CC1=C8[C@@H]([C@H](O1)C1=CC=C(C=C1)O)C1=CC(=CC(=C1)O)O)OC(=C9C1=CC=C(C=C1)O)C1=CC(=CC(=C1)O)O)O)O |
|
InChI
InChI=1S/C70H50O15/c71-40-11-3-34(4-12-40)59-62(52-29-49(80)31-56-66(52)67(53-28-48(79)30-55(82)63(53)59)69(83-56)37-9-17-43(74)18-10-37)51-21-33(2-20-54(51)81)1-19-50-64-57(85-70(39-24-46(77)27-47(78)25-39)60(64)35-5-13-41(72)14-6-35)32-58-65(50)61(38-22-44(75)26-45(76)23-38)68(84-58)36-7-15-42(73)16-8-36/h1-32,59,61-62,67-69,71-82H/b19-1+/t59-,61+,62+,67+,68-,69-/m1/s1
|
|
| Properties | |
| Molecular formula | C70H50O15 |
| Molar mass | 1131.14 g/mol |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) | |
Amurensin E is an oligostilbene found in Vitis amurensis. It is a pentamer of resveratrol.
All content from Kiddle encyclopedia articles (including the article images and facts) can be freely used under Attribution-ShareAlike license, unless stated otherwise. Cite this article:
Amurensin E Facts for Kids. Kiddle Encyclopedia.