Tetuin facts for kids
Quick facts for kids Tetuin |
|
---|---|
![]() |
|
IUPAC name | 5,7-dihydroxy-2-phenyl-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6(hydroxymethyl)oxan-2-yl]oxychromen-4-one |
Other names | Baicalein 6-glucoside Baicalein 6-O-glucoside |
Identifiers | |
CAS number | |
PubChem | |
SMILES | C1=CC=C(C=C1)C2=CC(=O)C3=C(C(=C(C=C3O2)O)OC4C(C(C(C(O4)CO)O)O)O)O |
Properties | |
Molecular formula | |
Molar mass | 0 g mol-1 |
Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) |
Tetuin is a special type of natural chemical found in plants. It belongs to a group of compounds called flavones, which are part of an even bigger family known as flavonoids. Think of flavonoids as tiny building blocks that give many plants their color and help them stay healthy.
Tetuin is also known as a "6-O-glucoside of baicalein". This means it's a specific version of another compound called baicalein, with a sugar molecule (glucose) attached to it.
Contents
What is Tetuin?
Tetuin is a natural compound found in certain plants. It's like a tiny, complex molecule that scientists study to understand how plants work. It's part of a large group of plant chemicals that are often good for health.
A Closer Look at Flavonoids
Flavonoids are a big family of natural compounds found in almost all fruits, vegetables, and plants. They are responsible for the bright colors in many plants, like the red in apples or the blue in blueberries. Flavonoids also help protect plants from diseases and damage. When we eat plants, these compounds can be good for our bodies too.
What is a Glucoside?
A glucoside is a type of chemical where a sugar molecule, specifically glucose, is connected to another non-sugar molecule. In the case of Tetuin, a glucose molecule is attached to baicalein. This attachment can change how the compound acts and how the body uses it. Many natural compounds in plants exist as glucosides.
Where Does Tetuin Come From?
Tetuin can be found in the seeds of a plant called Oroxylum indicum. This plant is also known as the Indian trumpetflower. In some parts of India, like Maharashtra, people call it tetu.
The Indian Trumpetflower
The Indian trumpetflower (Oroxylum indicum) is a tree native to India and other parts of Southeast Asia. It's known for its very long, flat, sword-shaped seed pods that hang from the branches. The tree also has large, bell-shaped flowers that bloom at night. Different parts of the Indian trumpetflower, including its seeds, have been used in traditional medicine for a long time. Scientists are still studying these plants to learn more about the compounds they contain, like Tetuin.