Miyabenol C facts for kids
Quick facts for kids Miyabenol C |
|
|---|---|
 |
|
|
Preferred IUPAC name
(2S,2′R,3S,3′R)-3′-(3,5-Dihydroxyphenyl)-2,2′-bis(4-hydroxyphenyl)-4-[(E)-2-(4-hydroxyphenyl)ethen-1-yl]-2,2′,3,3′-tetrahydro[3,5′-bi-1-benzofuran]-6,7′-diol
|
|
| Other names | Z-miyabenol C E-cis-miyabenol C |
| Identifiers | |
| CAS number | |
| PubChem | |
| ChEBI | CHEBI:76193 |
| SMILES | c1cc(ccc1/C=C/c2cc(cc3c2[C@@H]([C@H](O3)c4ccc(cc4)O)c5cc(cc6c5[C@H]([C@@H](O6)c7ccc(cc7)O)c8cc(cc(c8)O)O)O)O)O |
| Properties | |
| Molecular formula | |
| Molar mass | 0 g mol-1 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) | |
Miyabenol C is a natural chemical compound found in certain plants. It belongs to a group of compounds called stilbenoids. Think of it as a larger version of resveratrol, which is also found in grapes. Miyabenol C is a "trimer" of resveratrol, meaning it's made of three resveratrol units joined together.
Contents
Where Miyabenol C Is Found
Miyabenol C can be found in several different plants around the world. These plants produce this compound naturally.
Plants Containing Miyabenol C
- Vitis vinifera: This is the scientific name for the common grape vine. Grapes are well-known for containing many interesting natural compounds.
- Foeniculum vulgare: This plant is commonly known as fennel. People use fennel in cooking and for its distinct flavor.
- Caragana sinica: This plant is a type of flowering shrub. It is sometimes called the Chinese pea shrub.
What Miyabenol C Does
Scientists study compounds like Miyabenol C to understand how they affect living things. Miyabenol C has a special activity in cells.
How It Works in Cells
Miyabenol C can act as a protein kinase C inhibitor. This means it can slow down or stop the activity of certain proteins called "protein kinases" inside cells. Protein kinases are like tiny switches that control many important processes in our bodies. By inhibiting them, Miyabenol C might influence how cells work.
Related Compounds
Miyabenol C is part of a family of similar chemicals. One related compound is Foeniculoside I.
Foeniculoside I Connection
Foeniculoside I is a "glucoside" of cis-miyabenol C. This means it's Miyabenol C with a sugar molecule attached to it. Scientists often study these related compounds to learn more about their properties.
