Tetramethylpyrazine facts for kids
Quick facts for kids Tetramethylpyrazine |
|
|---|---|
 |
|
|
Preferred IUPAC name
Tetramethylpyrazine
|
|
| Other names | Ligustrazine; Tetrapyrazine |
| Identifiers | |
| CAS number | |
| PubChem | |
| EC number | 214-391-2 |
| ChEBI | CHEBI:133246 |
| SMILES | CC1=C(N=C(C(=N1)C)C)C |
|
InChI
InChI=1S/C8H12N2/c1-5-6(2)10-8(4)7(3)9-5/h1-4H3
|
|
| Properties | |
| Molecular formula | C8H12N2 |
| Molar mass | 136.19 g mol-1 |
| Melting point |
84-86 °C, 271 K, -39 °F |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) | |
Tetramethylpyrazine, also known as ligustrazine, is a chemical compound found in nattō and in fermented cocoa beans. In an observational study, tetramethylpyrazine was the dominant volatile organic compound in one sourdough starter. When purified, tetramethylpyrazine is a colorless solid. It is classified as an alkylpyrazine. Its biosynthesis involves amination of acetoin, the latter derived from pyruvate. It exhibits potential nootropic and antiinflammatory activities in rats.
See also
In Spanish: Tetrametilpirazina para niños
All content from Kiddle encyclopedia articles (including the article images and facts) can be freely used under Attribution-ShareAlike license, unless stated otherwise. Cite this article:
Tetramethylpyrazine Facts for Kids. Kiddle Encyclopedia.