kids encyclopedia robot

Endrin facts for kids

Kids Encyclopedia Facts
Quick facts for kids
Endrin
Endrin.svg
Endrin-3D-balls.png
IUPAC name (1R,2S,3R,6S,7R,8S,9S,11R)-3,4,5,6,13,13-Hexachloro-10-oxapentacyclo[6.3.1.13,6.02,7.09,11]tridec-4-ene
Other names Mendrin, Compound 269, (1aR,2S,2aS,3S,6R,6aR,7R,7aS)-3,4,5,6,9,9-hexachloro-1a,2,2a,3,6,6a,7,7a-octahydro-2,7:3,6-dimethanonaphtho[2,3-b]oxirene, 1,2,3,4,10,10-Hexachloro-6,7-epoxy-1,4,4a,5,6,7,8,8a-octahydro-1,4-endo,endo-5,8-dimethanonaphthalene
Identifiers
CAS number 72-20-8
PubChem 3048
KEGG C18124
ChEBI CHEBI:81526
RTECS number IO1575000
SMILES C1C2C3C(C1C4C2O4)C5(C(=C(C3(C5(Cl)Cl)Cl)Cl)Cl)Cl
Properties
Molecular formula
Molar mass 0 g mol-1
Appearance Colorless to tan crystalline solid
Density 1.77 g/cm3
Melting point
0.23 mg/L
Vapor pressure 2.6 x 10-5 Pa
Hazards
NFPA 704

NFPA 704.svg

0
2
0
 
Flash point noncombustible
U.S. Permissible
exposure limit (PEL)
TWA 0.1 mg/m3 [skin]
Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa)

Endrin is a powerful chemical that was once used to kill insects and rodents. It was very common for farmers who grew cotton and cereal crops. This chemical is a neurotoxin, which means it can harm the nervous system of living things.

Endrin is very similar to another chemical called Dieldrin. They are like mirror images of each other, which is what a stereoisomer means in chemistry.

Why Endrin is Harmful

Endrin is a very dangerous chemical. It can stay in the soil for a very long time, sometimes up to twelve years, before it breaks down. This means it can keep harming the environment and animals for many years.

Impact on Living Things

Because Endrin is a neurotoxin, it can be very harmful to animals and humans. Even small amounts can cause serious health problems. It can affect the brain and nerves, leading to sickness.

Environmental Concerns

When Endrin stays in the environment, it can pollute the soil and water. This pollution can then affect plants, animals, and even people who come into contact with it. Its long-lasting nature makes it a persistent organic pollutant.

Global Ban on Endrin

Because of how dangerous Endrin is, countries around the world decided to ban it.

The Stockholm Convention

Endrin is one of twelve chemicals listed in the Stockholm Convention on Persistent Organic Pollutants. This is an international agreement that aims to protect human health and the environment from chemicals that stay in the environment for a long time and can travel far.

When it was Banned

Since 2004, the production, trade, and use of Endrin have been completely banned in many countries. This ban helps to prevent more harm to people and the planet.

See also

A robot for kids, representing knowledge.

kids search engine
Endrin Facts for Kids. Kiddle Encyclopedia.