Acetoacetic acid facts for kids
Quick facts for kids Acetoacetic acid |
|
|---|---|
 |
|
 |
|
|
Preferred IUPAC name
3-Oxobutanoic acid
|
|
|
3-Oxobutyric acid
|
|
| Other names | Acetoacetic acid Diacetic acid Acetylacetic acid Acetonecarboxylic acid |
| Identifiers | |
| CAS number | |
| PubChem | |
| DrugBank | DB01762 |
| KEGG | C00164 |
| ChEBI | CHEBI:15344 |
| SMILES | O=C(C)CC(=O)O |
|
InChI
InChI=1/C4H6O3/c1-3(5)2-4(6)7/h2H2,1H3,(H,6,7)
|
|
| Properties | |
| Molecular formula | |
| Molar mass | 0 g mol-1 |
| Appearance | Colorless, oily liquid |
| Melting point | |
| Boiling point | |
| Soluble | |
| Solubility in organic solvents | Soluble in ethanol, ether |
| Acidity (pKa) | 3.58 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) | |
Acetoacetic acid, also known as 3-oxobutanoic acid or diacetic acid, is a special kind of organic compound in chemistry. Its chemical formula is CH3COCH2COOH. It is the simplest type of a "beta-keto acid," which means it has a specific arrangement of atoms. Like other chemicals in this group, it can be a bit unstable on its own.
However, some related forms, called "esters" (like methyl acetoacetate and ethyl acetoacetate), are much more stable. These stable forms are very important in industries, where they are used to make things like dyes for coloring. Acetoacetic acid is also known as a weak acid.
Contents
How Our Bodies Use Acetoacetic Acid
Inside our bodies, especially in the liver, acetoacetic acid usually exists in a slightly different form called acetoacetate. This change happens easily:
- AcCH
2CO
2H → AcCH
2CO−
2 + H+
This means the acid loses a hydrogen atom, becoming its "conjugate base." Our liver cells make acetoacetate from other chemicals, like a molecule called coenzyme A (CoA). This process is like a mini-factory inside our cells, creating acetoacetate from different starting materials.
When we haven't eaten for a while, or during exercise, or if someone has certain health conditions, the body needs extra energy. That's when the liver releases acetoacetate and other similar chemicals, called "ketone bodies," into the blood. These ketone bodies act as an alternative fuel source. Our heart muscles and kidneys really like using acetoacetate for energy. Even our brain can switch to using acetoacetate when there isn't enough glucose (sugar) available. It's like our body has a backup fuel tank!
Making and Changing Acetoacetic Acid
Scientists can make acetoacetic acid in the lab by breaking down another chemical called diketene. It's often made at very cold temperatures (around 0 degrees Celsius) and used right away because it doesn't stay stable for long.
Acetoacetic acid can easily break down into two simpler substances: acetone (which you might know from nail polish remover) and carbon dioxide (the gas we breathe out). This chemical reaction looks like this:
- CH
3C(O)CH
2CO
2H → CH
3C(O)CH
3 + CO
2
This breakdown happens fairly quickly. The acid form breaks down faster than its basic form.
Remember, acetoacetic acid is a weak acid, similar to many other acids found in nature. It has a pKa value of 3.58.
Acetoacetic acid is interesting because it can exist in two slightly different forms, called "keto" and "enol" forms. It's like having two different outfits for the same molecule! The environment around it, like whether it's in water or another liquid, can change which form is more common.
How We Detect Acetoacetic Acid
Doctors and scientists can check for acetoacetic acid in urine. This is important for people who need to monitor their body's energy use, especially if they are on special diets (like a ketogenic diet which is low in carbohydrates) or have health conditions that affect how their body uses sugar.
A simple test uses special paper strips, called "dipsticks." These strips have a chemical on them that changes color (from pink to purple) when acetoacetate is present. The color change helps show how much acetoacetate is there.
This test is useful, but it mainly detects acetoacetate. It doesn't measure another important "ketone body" called beta-hydroxybutyrate. So, sometimes, the test might not show the full picture of all the ketone bodies. Similar tests are also used for dairy cows to check their health and energy levels.
See also
- 3-Hydroxybutyrate dehydrogenase
- Ethyl acetoacetate
