2-Pentanone facts for kids
Quick facts for kids 2-Pentanone |
|
|---|---|
|
Preferred IUPAC name
Pentan-2-one
|
|
| Other names | methyl propyl ketone 2-pentanone MPK |
| Identifiers | |
| CAS number | |
| PubChem | |
| KEGG | C01949 |
| ChEBI | CHEBI:16472 |
| RTECS number | CY1400000 |
| SMILES | O=C(C)CCC |
|
InChI
InChI=1/C5H10O/c1-3-4-5(2)6/h3-4H2,1-2H3
|
|
| Properties | |
| Molecular formula | |
| Molar mass | 0 g mol-1 |
| Appearance | Colorless liquid |
| Odor | resembling acetone |
| Density | 0.809 g/ml |
| Melting point | |
| Boiling point | |
| 6% (20°C) | |
| Vapor pressure | 3.6 kPa (20 °C) |
| -57.41·10−6 cm3/mol | |
| Refractive index (nD) | 1.390 (20 °C) |
| Viscosity | 0.50 mPa·s (20 °C) |
| Hazards | |
| Flash point | 10 °C (50 °F) |
| Explosive limits | 1.5%-8.2% |
| U.S. Permissible exposure limit (PEL) |
TWA 200 ppm (700 mg/m3) |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) | |
2-Pentanone, also known as methyl propyl ketone (MPK), is a type of organic compound. It belongs to a group of chemicals called ketones. This chemical is quite similar to another one called butanone. However, making 2-pentanone costs more money. Because of this, it is not used as often as a solvent (a liquid that dissolves other substances). You can find small amounts of 2-pentanone in tobacco.
What is 2-Pentanone?
2-Pentanone is a clear liquid that doesn't have a color. It has a smell that reminds people of acetone, which is often used in nail polish remover. Its chemical formula is C5H10O. This means each molecule of 2-pentanone has 5 carbon atoms, 10 hydrogen atoms, and 1 oxygen atom.
How is it Used?
Even though it's not as common as some other solvents, 2-pentanone can still dissolve many things. It's sometimes used in special chemical processes. Because it's a ketone, it has properties that make it useful in certain industries.
Safety Information
2-Pentanone is a flammable liquid. This means it can easily catch fire, especially when it's warm. Its flash point, the lowest temperature at which its vapors can ignite, is 10 degrees Celsius (50 degrees Fahrenheit). It's important to handle it carefully and keep it away from heat or flames.
Where is it Found?
Besides being made in labs, 2-pentanone can be found naturally in some places. For example, it is present in small amounts in tobacco plants. Scientists study these compounds to understand their roles in nature.
See also
In Spanish: Pentan-2-ona para niños