2-Pentanone facts for kids
Quick facts for kids 2-Pentanone |
|
|---|---|
 |
|
 |
|
|
Preferred IUPAC name
Pentan-2-one
|
|
| Other names | methyl propyl ketone 2-pentanone MPK |
| Identifiers | |
| CAS number | |
| PubChem | |
| KEGG | C01949 |
| ChEBI | CHEBI:16472 |
| RTECS number | CY1400000 |
| SMILES | O=C(C)CCC |
|
InChI
InChI=1/C5H10O/c1-3-4-5(2)6/h3-4H2,1-2H3
|
|
| Properties | |
| Molecular formula | C5H10O |
| Molar mass | 86.13 g/mol |
| Appearance | Colorless liquid |
| Odor | resembling acetone |
| Density | 0.809 g/ml |
| Melting point |
-78 °C, 195 K, -108 °F |
| Boiling point |
102 °C, 375 K, 216 °F |
| Solubility in water | 6% (20°C) |
| Vapor pressure | 3.6 kPa (20 °C) |
| -57.41·10−6 cm3/mol | |
| Refractive index (nD) | 1.390 (20 °C) |
| Viscosity | 0.50 mPa·s (20 °C) |
| Hazards | |
| Flash point | 10 °C (50 °F) |
| Explosive limits | 1.5%-8.2% |
| U.S. Permissible exposure limit (PEL) |
TWA 200 ppm (700 mg/m3) |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) | |
2-pentanone, or methyl propyl ketone (MPK), is an organic compound. It is a ketone and is very similar to butanone, but it is more expensive to make. Because of this, it isn't used as a solvent as often as butanone. Some of it is found in tobacco.
See also
In Spanish: Pentan-2-ona para niños
All content from Kiddle encyclopedia articles (including the article images and facts) can be freely used under Attribution-ShareAlike license, unless stated otherwise. Cite this article:
2-Pentanone Facts for Kids. Kiddle Encyclopedia.