3-Pentanone facts for kids
Quick facts for kids 3-Pentanone |
|
|---|---|
 |
|
 |
|
|
Preferred IUPAC name
Pentan-3-one
|
|
| Other names | Diethyl ketone, diethylketone, 3-pentanone, dimethyl acetone, propione, metacetone, methacetone, ethyl ketone |
| Identifiers | |
| Abbreviations | DEK |
| CAS number | |
| ChEBI | CHEBI:87755 |
| SMILES | O=C(CC)CC |
|
InChI
InChI=1/C5H10O/c1-3-5(6)4-2/h3-4H2,1-2H3
|
|
| Properties | |
| Molecular formula | C5H10O |
| Molar mass | 86.13 g mol-1 |
| Appearance | Colorless liquid |
| Odor | Acetone-like |
| Density | 0.81 g/cm3 at 20 °C |
| Melting point |
-39 °C, 234 K, -38 °F |
| Boiling point |
102 °C, 375 K, 216 °F |
| Solubility in water | 35 g/L |
| Vapor pressure | 35 mmHg |
| -58.14·10−6 cm3/mol | |
| Hazards | |
| Explosive limits | 1.6%-6.4% |
| U.S. Permissible exposure limit (PEL) |
none |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) | |
3-Pentanone, also called diethyl ketone, is an organic compound. It is a ketone with five carbon atoms. It smells like acetone and is soluble in water. It is used as a solvent in paint and is used to make vitamin E.
See also
In Spanish: 3-pentanona para niños
All content from Kiddle encyclopedia articles (including the article images and facts) can be freely used under Attribution-ShareAlike license, unless stated otherwise. Cite this article:
3-Pentanone Facts for Kids. Kiddle Encyclopedia.